C21H19ClN4O5S — CID 6301502
(Z)-2-chloro-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 6301502) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is (Z)-2-chloro-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-chloro-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6301502 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (Z)-2-chloro-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)/C(Cl)=C/c3ccccc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C21H19ClN4O5S/c1-30-19-13-18(24-21(25-19)31-2)26-32(28,29)16-10-8-15(9-11-16)23-20(27)17(22)12-14-6-4-3-5-7-14/h3-13H,1-2H3,(H,23,27)(H,24,25,26)/b17-12- |
| InChIKey | FOALJDKHXRZEMO-ATVHPVEESA-N |
| XLogP | 3.51 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|