C29H27N5O7S — CID 3114470
N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3114470) has the molecular formula C29H27N5O7S and a molecular weight of 589.63 g/mol. Its IUPAC name is N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3114470 |
| Molecular Formula | C29H27N5O7S |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)Nc2ccc(S(=O)(=O)Nc3cc(OC)nc(OC)n3)cc2)cc1 |
| InChI | InChI=1S/C29H27N5O7S/c1-39-22-13-9-19(10-14-22)17-24(31-27(35)20-7-5-4-6-8-20)28(36)30-21-11-15-23(16-12-21)42(37,38)34-25-18-26(40-2)33-29(32-25)41-3/h4-18H,1-3H3,(H,30,36)(H,31,35)(H,32,33,34) |
| InChIKey | SHIAFDWUWRQURS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|