C27H24N6O6S — CID 3122774
N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide (PubChem CID 3122774) has the molecular formula C27H24N6O6S and a molecular weight of 560.59 g/mol. Its IUPAC name is N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3122774 |
| Molecular Formula | C27H24N6O6S |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | N-[3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)C(=Cc3ccncc3)NC(=O)c3ccccc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C27H24N6O6S/c1-38-24-17-23(31-27(32-24)39-2)33-40(36,37)21-10-8-20(9-11-21)29-26(35)22(16-18-12-14-28-15-13-18)30-25(34)19-6-4-3-5-7-19/h3-17H,1-2H3,(H,29,35)(H,30,34)(H,31,32,33) |
| InChIKey | IDWOUHPRFXXNBW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|