C22H22N4O5S — CID 4630807
N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 4630807) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4630807 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)C=Cc3ccc(C)cc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C22H22N4O5S/c1-15-4-6-16(7-5-15)8-13-20(27)23-17-9-11-18(12-10-17)32(28,29)26-19-14-21(30-2)25-22(24-19)31-3/h4-14H,1-3H3,(H,23,27)(H,24,25,26) |
| InChIKey | HWJIKJLGCPQQAF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|