C24H24N2O3S — CID 6128596
(E)-N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 6128596) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is (E)-N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6128596 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (E)-N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O3S/c1-17-4-7-20(8-5-17)9-15-24(27)25-21-11-13-23(14-12-21)30(28,29)26-22-10-6-18(2)19(3)16-22/h4-16,26H,1-3H3,(H,25,27)/b15-9+ |
| InChIKey | PUIQYOYQOPMDRZ-OQLLNIDSSA-N |
| XLogP | 5.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|