C22H21N3O3S — CID 85314407
N-(2-aminophenyl)-3-[4-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 85314407) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 85314407 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C=CC(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-16-6-11-18(12-7-16)25-29(27,28)19-13-8-17(9-14-19)10-15-22(26)24-21-5-3-2-4-20(21)23/h2-15,25H,23H2,1H3,(H,24,26) |
| InChIKey | FVMOHEFQXYYGSP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|