C23H21FN2O4S — CID 26666081
(E)-N-(2-fluoro-4-methylphenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 26666081) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is (E)-N-(2-fluoro-4-methylphenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-fluoro-4-methylphenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26666081 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (E)-N-(2-fluoro-4-methylphenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/C(=O)Nc3ccc(C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O4S/c1-16-3-13-22(21(24)15-16)25-23(27)14-6-17-4-11-20(12-5-17)31(28,29)26-18-7-9-19(30-2)10-8-18/h3-15,26H,1-2H3,(H,25,27)/b14-6+ |
| InChIKey | NLZXJYJXEXETEA-MKMNVTDBSA-N |
| XLogP | 4.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|