C22H17F4N3O4S — CID 2127250
N-(4-methoxyphenyl)-4-[(E)-3-oxo-3-[2-(2,3,5,6-tetrafluorophenyl)hydrazinyl]prop-1-enyl]benzenesulfonamide (PubChem CID 2127250) has the molecular formula C22H17F4N3O4S and a molecular weight of 495.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[(E)-3-oxo-3-[2-(2,3,5,6-tetrafluorophenyl)hydrazinyl]prop-1-enyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-4-[(E)-3-oxo-3-[2-(2,3,5,6-tetrafluorophenyl)hydrazinyl]prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2127250 |
| Molecular Formula | C22H17F4N3O4S |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[(E)-3-oxo-3-[2-(2,3,5,6-tetrafluorophenyl)hydrazinyl]prop-1-enyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/C(=O)NNc3c(F)c(F)cc(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C22H17F4N3O4S/c1-33-15-7-5-14(6-8-15)29-34(31,32)16-9-2-13(3-10-16)4-11-19(30)27-28-22-20(25)17(23)12-18(24)21(22)26/h2-12,28-29H,1H3,(H,27,30)/b11-4+ |
| InChIKey | DBWWCFPLDORSCL-NYYWCZLTSA-N |
| XLogP | 4.21 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|