C16H12F5N3O3S — CID 35619967
N-[4-[(E)-3-oxo-3-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]prop-1-enyl]phenyl]methanesulfonamide (PubChem CID 35619967) has the molecular formula C16H12F5N3O3S and a molecular weight of 421.35 g/mol. Its IUPAC name is N-[4-[(E)-3-oxo-3-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]prop-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-3-oxo-3-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]prop-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 35619967 |
| Molecular Formula | C16H12F5N3O3S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-[4-[(E)-3-oxo-3-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]prop-1-enyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)NNc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H12F5N3O3S/c1-28(26,27)24-9-5-2-8(3-6-9)4-7-10(25)22-23-16-14(20)12(18)11(17)13(19)15(16)21/h2-7,23-24H,1H3,(H,22,25)/b7-4+ |
| InChIKey | XRPLKIXFYJFDBH-QPJJXVBHSA-N |
| XLogP | 2.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|