C14H18N2O5S — CID 91942717
4-[3-[4-(methanesulfonamido)phenyl]prop-2-enoylamino]butanoic acid (PubChem CID 91942717) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-[3-[4-(methanesulfonamido)phenyl]prop-2-enoylamino]butanoic acid.
| Compound Name | 4-[3-[4-(methanesulfonamido)phenyl]prop-2-enoylamino]butanoic acid |
|---|---|
| PubChem CID | 91942717 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[3-[4-(methanesulfonamido)phenyl]prop-2-enoylamino]butanoic acid |
| SMILES | CS(=O)(=O)Nc1ccc(C=CC(=O)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O5S/c1-22(20,21)16-12-7-4-11(5-8-12)6-9-13(17)15-10-2-3-14(18)19/h4-9,16H,2-3,10H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | GUYFLUHBXIQZGE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|