C20H24FN3O3S — CID 55978085
N-[3-(2-fluoro-N-methylanilino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 55978085) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[3-(2-fluoro-N-methylanilino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | N-[3-(2-fluoro-N-methylanilino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55978085 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-(2-fluoro-N-methylanilino)propyl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CN(CCCNC(=O)C=Cc1ccc(NS(C)(=O)=O)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H24FN3O3S/c1-24(19-7-4-3-6-18(19)21)15-5-14-22-20(25)13-10-16-8-11-17(12-9-16)23-28(2,26)27/h3-4,6-13,23H,5,14-15H2,1-2H3,(H,22,25) |
| InChIKey | OXUDTCWNFSPCGM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|