C15H26Cl2FN3O — CID 120503280
3-amino-N-[3-(2-fluoro-N-methylanilino)propyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120503280) has the molecular formula C15H26Cl2FN3O and a molecular weight of 354.30 g/mol. Its IUPAC name is 3-amino-N-[3-(2-fluoro-N-methylanilino)propyl]-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-[3-(2-fluoro-N-methylanilino)propyl]-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120503280 |
| Molecular Formula | C15H26Cl2FN3O |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-amino-N-[3-(2-fluoro-N-methylanilino)propyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCCN(C)c1ccccc1F.Cl.Cl |
| InChI | InChI=1S/C15H24FN3O.2ClH/c1-11(12(2)17)15(20)18-9-6-10-19(3)14-8-5-4-7-13(14)16;;/h4-5,7-8,11-12H,6,9-10,17H2,1-3H3,(H,18,20);2*1H |
| InChIKey | FMUZBXNYDDVDTQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|