C21H27F2N3O3S2 — CID 55954994
N-[3-(2-fluoro-N-methylanilino)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 55954994) has the molecular formula C21H27F2N3O3S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[3-(2-fluoro-N-methylanilino)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-[3-(2-fluoro-N-methylanilino)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55954994 |
| Molecular Formula | C21H27F2N3O3S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[3-(2-fluoro-N-methylanilino)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)NCCCN(C)c1ccccc1F |
| InChI | InChI=1S/C21H27F2N3O3S2/c1-26(19-10-5-3-8-16(19)22)14-7-13-24-21(27)18(12-15-30-2)25-31(28,29)20-11-6-4-9-17(20)23/h3-6,8-11,18,25H,7,12-15H2,1-2H3,(H,24,27) |
| InChIKey | AVGHDIQTUBKJKD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|