C23H30FN3O3S2 — CID 55635522
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 55635522) has the molecular formula C23H30FN3O3S2 and a molecular weight of 479.64 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55635522 |
| Molecular Formula | C23H30FN3O3S2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H30FN3O3S2/c1-31-16-12-21(26-32(29,30)22-10-5-4-9-20(22)24)23(28)25-13-6-14-27-15-11-18-7-2-3-8-19(18)17-27/h2-5,7-10,21,26H,6,11-17H2,1H3,(H,25,28) |
| InChIKey | HXBXYAJROIKUFF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|