C18H28FN3O4S2 — CID 55638466
2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(2-morpholin-4-ylpropyl)butanamide (PubChem CID 55638466) has the molecular formula C18H28FN3O4S2 and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(2-morpholin-4-ylpropyl)butanamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(2-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 55638466 |
| Molecular Formula | C18H28FN3O4S2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(2-morpholin-4-ylpropyl)butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C18H28FN3O4S2/c1-14(22-8-10-26-11-9-22)13-20-18(23)16(7-12-27-2)21-28(24,25)17-6-4-3-5-15(17)19/h3-6,14,16,21H,7-13H2,1-2H3,(H,20,23) |
| InChIKey | XYRRJKCABYXERE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |