C16H19FN2O3S3 — CID 55689276
2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(thiophen-3-ylmethyl)butanamide (PubChem CID 55689276) has the molecular formula C16H19FN2O3S3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(thiophen-3-ylmethyl)butanamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(thiophen-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 55689276 |
| Molecular Formula | C16H19FN2O3S3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanyl-N-(thiophen-3-ylmethyl)butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)NCc1ccsc1 |
| InChI | InChI=1S/C16H19FN2O3S3/c1-23-8-7-14(16(20)18-10-12-6-9-24-11-12)19-25(21,22)15-5-3-2-4-13(15)17/h2-6,9,11,14,19H,7-8,10H2,1H3,(H,18,20) |
| InChIKey | MBFMZNVJGRMSJK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |