C17H18F2N2O3S2 — CID 55333970
N-(4-fluorophenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 55333970) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-(4-fluorophenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55333970 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18F2N2O3S2/c1-25-11-10-15(17(22)20-13-8-6-12(18)7-9-13)21-26(23,24)16-5-3-2-4-14(16)19/h2-9,15,21H,10-11H2,1H3,(H,20,22) |
| InChIKey | NARQHPIGZXKMEU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |