C21H27FN2O3S2 — CID 24537921
N-(4-butylphenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 24537921) has the molecular formula C21H27FN2O3S2 and a molecular weight of 438.59 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-(4-butylphenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24537921 |
| Molecular Formula | C21H27FN2O3S2 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-(4-butylphenyl)-2-[(2-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CCCCc1ccc(NC(=O)C(CCSC)NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H27FN2O3S2/c1-3-4-7-16-10-12-17(13-11-16)23-21(25)19(14-15-28-2)24-29(26,27)20-9-6-5-8-18(20)22/h5-6,8-13,19,24H,3-4,7,14-15H2,1-2H3,(H,23,25) |
| InChIKey | AFJIAORCHNVEJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |