C17H20FN3O3S2 — CID 24687371
2-[(2-fluorophenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)-4-methylsulfanylbutanamide (PubChem CID 24687371) has the molecular formula C17H20FN3O3S2 and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)-4-methylsulfanylbutanamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24687371 |
| Molecular Formula | C17H20FN3O3S2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1F)C(=O)Nc1cccc(C)n1 |
| InChI | InChI=1S/C17H20FN3O3S2/c1-12-6-5-9-16(19-12)20-17(22)14(10-11-25-2)21-26(23,24)15-8-4-3-7-13(15)18/h3-9,14,21H,10-11H2,1-2H3,(H,19,20,22) |
| InChIKey | QTOXBLFFQGQUIA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |