C18H23FN2O4S3 — CID 41136094
(2R)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methylsulfanylbutanamide (PubChem CID 41136094) has the molecular formula C18H23FN2O4S3 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2R)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 41136094 |
| Molecular Formula | C18H23FN2O4S3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (2R)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](NS(=O)(=O)c1ccccc1F)C(=O)NCCSCc1ccco1 |
| InChI | InChI=1S/C18H23FN2O4S3/c1-26-11-8-16(21-28(23,24)17-7-3-2-6-15(17)19)18(22)20-9-12-27-13-14-5-4-10-25-14/h2-7,10,16,21H,8-9,11-13H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | IPKMROJBWLHZNF-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|