C23H31N3O4S2 — CID 55574026
2-(benzenesulfonamido)-4-methylsulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide (PubChem CID 55574026) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-methylsulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide.
| Compound Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 55574026 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)NCC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C23H31N3O4S2/c1-31-17-12-21(25-32(28,29)20-10-6-3-7-11-20)23(27)24-18-22(19-8-4-2-5-9-19)26-13-15-30-16-14-26/h2-11,21-22,25H,12-18H2,1H3,(H,24,27) |
| InChIKey | JRHSNKWAUCCNQI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |