C18H29N3O2 — CID 119853237
(2S)-2-amino-3,3-dimethyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide (PubChem CID 119853237) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 119853237 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-(2-morpholin-4-yl-2-phenylethyl)butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H29N3O2/c1-18(2,3)16(19)17(22)20-13-15(14-7-5-4-6-8-14)21-9-11-23-12-10-21/h4-8,15-16H,9-13,19H2,1-3H3,(H,20,22)/t15?,16-/m1/s1 |
| InChIKey | JBBHZEZXXYYTPD-OEMAIJDKSA-N |
| XLogP | 1.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |