C14H23N3O — CID 122080430
(2S)-2-amino-N-(2-amino-2-phenylethyl)-3,3-dimethylbutanamide (PubChem CID 122080430) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-amino-2-phenylethyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(2-amino-2-phenylethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 122080430 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (2S)-2-amino-N-(2-amino-2-phenylethyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCC(N)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O/c1-14(2,3)12(16)13(18)17-9-11(15)10-7-5-4-6-8-10/h4-8,11-12H,9,15-16H2,1-3H3,(H,17,18)/t11?,12-/m1/s1 |
| InChIKey | LTBSECPMCLKKTL-PIJUOVFKSA-N |
| XLogP | 1.18 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |