C18H31N3O — CID 119399219
(2S)-2-amino-N-[2-(diethylamino)-2-phenylethyl]-3,3-dimethylbutanamide (PubChem CID 119399219) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(diethylamino)-2-phenylethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(diethylamino)-2-phenylethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119399219 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (2S)-2-amino-N-[2-(diethylamino)-2-phenylethyl]-3,3-dimethylbutanamide |
| SMILES | CCN(CC)C(CNC(=O)[C@@H](N)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H31N3O/c1-6-21(7-2)15(14-11-9-8-10-12-14)13-20-17(22)16(19)18(3,4)5/h8-12,15-16H,6-7,13,19H2,1-5H3,(H,20,22)/t15?,16-/m1/s1 |
| InChIKey | PDLLXUWMDJPZBU-OEMAIJDKSA-N |
| XLogP | 2.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |