C18H27Cl2N3OS — CID 119849729
2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylacetamide;dihydrochloride (PubChem CID 119849729) has the molecular formula C18H27Cl2N3OS and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylacetamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119849729 |
| Molecular Formula | C18H27Cl2N3OS |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylacetamide;dihydrochloride |
| SMILES | CCN(CC)C(CNC(=O)C(N)c1ccccc1)c1ccsc1.Cl.Cl |
| InChI | InChI=1S/C18H25N3OS.2ClH/c1-3-21(4-2)16(15-10-11-23-13-15)12-20-18(22)17(19)14-8-6-5-7-9-14;;/h5-11,13,16-17H,3-4,12,19H2,1-2H3,(H,20,22);2*1H |
| InChIKey | GKRDHVPBTPJNIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |