C17H29N3OS — CID 119849782
1-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]cyclohexane-1-carboxamide (PubChem CID 119849782) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is 1-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119849782 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]cyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)C1(N)CCCCC1)c1ccsc1 |
| InChI | InChI=1S/C17H29N3OS/c1-3-20(4-2)15(14-8-11-22-13-14)12-19-16(21)17(18)9-6-5-7-10-17/h8,11,13,15H,3-7,9-10,12,18H2,1-2H3,(H,19,21) |
| InChIKey | NMBMUFLIAPSXEW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |