C19H29Cl2N3OS — CID 120595403
2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylpropanamide;dihydrochloride (PubChem CID 120595403) has the molecular formula C19H29Cl2N3OS and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595403 |
| Molecular Formula | C19H29Cl2N3OS |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-amino-N-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-phenylpropanamide;dihydrochloride |
| SMILES | CCN(CC)C(CNC(=O)C(C)(N)c1ccccc1)c1ccsc1.Cl.Cl |
| InChI | InChI=1S/C19H27N3OS.2ClH/c1-4-22(5-2)17(15-11-12-24-14-15)13-21-18(23)19(3,20)16-9-7-6-8-10-16;;/h6-12,14,17H,4-5,13,20H2,1-3H3,(H,21,23);2*1H |
| InChIKey | CNXCYMAUXBRONU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |