C18H33N5OS — CID 111383191
N-tert-butyl-2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111383191) has the molecular formula C18H33N5OS and a molecular weight of 367.56 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383191 |
| Molecular Formula | C18H33N5OS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | CCN(CC)C(CN/C(=N/C)NCC(=O)NC(C)(C)C)c1ccsc1 |
| InChI | InChI=1S/C18H33N5OS/c1-7-23(8-2)15(14-9-10-25-13-14)11-20-17(19-6)21-12-16(24)22-18(3,4)5/h9-10,13,15H,7-8,11-12H2,1-6H3,(H,22,24)(H2,19,20,21) |
| InChIKey | FLSRFVLAQGHNRW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|