C20H34ClN5O — CID 111323978
N-tert-butyl-2-[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111323978) has the molecular formula C20H34ClN5O and a molecular weight of 395.98 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111323978 |
| Molecular Formula | C20H34ClN5O |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | CCN(CC)C(CN/C(=N/C)NCC(=O)NC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C20H34ClN5O/c1-7-26(8-2)17(15-11-9-10-12-16(15)21)13-23-19(22-6)24-14-18(27)25-20(3,4)5/h9-12,17H,7-8,13-14H2,1-6H3,(H,25,27)(H2,22,23,24) |
| InChIKey | JKLSYFYDPGTPGA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|