C19H33ClN4O3S — CID 111515957
1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111515957) has the molecular formula C19H33ClN4O3S and a molecular weight of 433.02 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111515957 |
| Molecular Formula | C19H33ClN4O3S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | CCN(CC)C(CN/C(=N/C)NCCOCCS(C)(=O)=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H33ClN4O3S/c1-5-24(6-2)18(16-9-7-8-10-17(16)20)15-23-19(21-3)22-11-12-27-13-14-28(4,25)26/h7-10,18H,5-6,11-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | WEJVPXXUYPBVRS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|