C19H30ClN7 — CID 111323850
1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine (PubChem CID 111323850) has the molecular formula C19H30ClN7 and a molecular weight of 391.95 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111323850 |
| Molecular Formula | C19H30ClN7 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine |
| SMILES | CCN(CC)C(CN/C(=N/C)NCc1nnc(C)n1C)c1ccccc1Cl |
| InChI | InChI=1S/C19H30ClN7/c1-6-27(7-2)17(15-10-8-9-11-16(15)20)12-22-19(21-4)23-13-18-25-24-14(3)26(18)5/h8-11,17H,6-7,12-13H2,1-5H3,(H2,21,22,23) |
| InChIKey | GAQIMRSABHGZTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|