C23H31ClIN7 — CID 111323955
1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111323955) has the molecular formula C23H31ClIN7 and a molecular weight of 567.91 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111323955 |
| Molecular Formula | C23H31ClIN7 |
| Molecular Weight | 567.91 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[(6-imidazol-1-yl-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCc1ccc(-n2ccnc2)nc1)c1ccccc1Cl.I |
| InChI | InChI=1S/C23H30ClN7.HI/c1-4-30(5-2)21(19-8-6-7-9-20(19)24)16-29-23(25-3)28-15-18-10-11-22(27-14-18)31-13-12-26-17-31;/h6-14,17,21H,4-5,15-16H2,1-3H3,(H2,25,28,29);1H |
| InChIKey | YAOMCULHZGWARW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|