C19H27ClF2N6 — CID 111323992
1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine (PubChem CID 111323992) has the molecular formula C19H27ClF2N6 and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111323992 |
| Molecular Formula | C19H27ClF2N6 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine |
| SMILES | CCN(CC)C(CN/C(=N/C)NCc1nccn1C(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClF2N6/c1-4-27(5-2)16(14-8-6-7-9-15(14)20)12-25-19(23-3)26-13-17-24-10-11-28(17)18(21)22/h6-11,16,18H,4-5,12-13H2,1-3H3,(H2,23,25,26) |
| InChIKey | RRAPUPMGDQVLIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|