C24H35ClIN5O — CID 111323961
4-[[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111323961) has the molecular formula C24H35ClIN5O and a molecular weight of 571.94 g/mol. Its IUPAC name is 4-[[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111323961 |
| Molecular Formula | C24H35ClIN5O |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 4-[[[N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCc1ccc(C(=O)N(C)C)cc1)c1ccccc1Cl.I |
| InChI | InChI=1S/C24H34ClN5O.HI/c1-6-30(7-2)22(20-10-8-9-11-21(20)25)17-28-24(26-3)27-16-18-12-14-19(15-13-18)23(31)29(4)5;/h8-15,22H,6-7,16-17H2,1-5H3,(H2,26,27,28);1H |
| InChIKey | TXIBDYFSRUMCCV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|