C16H25ClN2O — CID 34948840
N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]butanamide (PubChem CID 34948840) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]butanamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 34948840 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]butanamide |
| SMILES | CCCC(=O)NC[C@@H](c1ccccc1Cl)N(CC)CC |
| InChI | InChI=1S/C16H25ClN2O/c1-4-9-16(20)18-12-15(19(5-2)6-3)13-10-7-8-11-14(13)17/h7-8,10-11,15H,4-6,9,12H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | VZJFZEVHRHUEBT-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |