C20H25Cl2N3O — CID 97099413
2-(6-chloro-2-methyl-3-pyridinyl)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]acetamide (PubChem CID 97099413) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-(6-chloro-2-methyl-3-pyridinyl)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]acetamide.
| Compound Name | 2-(6-chloro-2-methyl-3-pyridinyl)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 97099413 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-(6-chloro-2-methyl-3-pyridinyl)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]acetamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)Cc1ccc(Cl)nc1C)c1ccccc1Cl |
| InChI | InChI=1S/C20H25Cl2N3O/c1-4-25(5-2)18(16-8-6-7-9-17(16)21)13-23-20(26)12-15-10-11-19(22)24-14(15)3/h6-11,18H,4-5,12-13H2,1-3H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | ZBMJWKLKRFXXDK-SFHVURJKSA-N |
| XLogP | 4.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|