C16H21ClN4OS — CID 26834158
N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 26834158) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 26834158 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)c1snnc1C)c1ccccc1Cl |
| InChI | InChI=1S/C16H21ClN4OS/c1-4-21(5-2)14(12-8-6-7-9-13(12)17)10-18-16(22)15-11(3)19-20-23-15/h6-9,14H,4-5,10H2,1-3H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | AIVUKQGPGHYDNX-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |