C17H30Cl3N3O — CID 120502499
3-amino-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120502499) has the molecular formula C17H30Cl3N3O and a molecular weight of 398.81 g/mol. Its IUPAC name is 3-amino-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120502499 |
| Molecular Formula | C17H30Cl3N3O |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-amino-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CCN(CC)C(CNC(=O)C(C)C(C)N)c1ccccc1Cl.Cl.Cl |
| InChI | InChI=1S/C17H28ClN3O.2ClH/c1-5-21(6-2)16(14-9-7-8-10-15(14)18)11-20-17(22)12(3)13(4)19;;/h7-10,12-13,16H,5-6,11,19H2,1-4H3,(H,20,22);2*1H |
| InChIKey | NGLIUAMTNANHIF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |