C20H23ClF2N2OS — CID 18269959
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(difluoromethylsulfanyl)benzamide (PubChem CID 18269959) has the molecular formula C20H23ClF2N2OS and a molecular weight of 412.93 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 18269959 |
| Molecular Formula | C20H23ClF2N2OS |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(difluoromethylsulfanyl)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(SC(F)F)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClF2N2OS/c1-3-25(4-2)18(16-7-5-6-8-17(16)21)13-24-19(26)14-9-11-15(12-10-14)27-20(22)23/h5-12,18,20H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | OKJBVFHLYWGGBX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |