C21H27ClN2O3 — CID 18161543
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3,4-dimethoxybenzamide (PubChem CID 18161543) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18161543 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(OC)c(OC)c1)c1ccccc1Cl |
| InChI | InChI=1S/C21H27ClN2O3/c1-5-24(6-2)18(16-9-7-8-10-17(16)22)14-23-21(25)15-11-12-19(26-3)20(13-15)27-4/h7-13,18H,5-6,14H2,1-4H3,(H,23,25) |
| InChIKey | ASMXLTQEJYMPMG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |