C22H30N2O4 — CID 51283235
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 51283235) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51283235 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(OC)c(OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H30N2O4/c1-6-24(7-2)19(16-9-8-10-18(13-16)26-3)15-23-22(25)17-11-12-20(27-4)21(14-17)28-5/h8-14,19H,6-7,15H2,1-5H3,(H,23,25) |
| InChIKey | PLSSHIHJQIWUKI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |