C26H31N3O3 — CID 43054752
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 43054752) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43054752 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(OCc2ccncc2)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C26H31N3O3/c1-4-29(5-2)25(22-7-6-8-24(17-22)31-3)18-28-26(30)21-9-11-23(12-10-21)32-19-20-13-15-27-16-14-20/h6-17,25H,4-5,18-19H2,1-3H3,(H,28,30) |
| InChIKey | IYGBRPUQTCMLMN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |