C19H25N3O3 — CID 30546325
N-[(2R)-2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 30546325) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2R)-2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[(2R)-2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 30546325 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(2R)-2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)c1ccc[n+]([O-])c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-4-21(5-2)18(15-8-6-10-17(12-15)25-3)13-20-19(23)16-9-7-11-22(24)14-16/h6-12,14,18H,4-5,13H2,1-3H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | LJHUFHJYNXYEEJ-SFHVURJKSA-N |
| XLogP | 2.14 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|