C27H33N3O4S — CID 46538069
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 46538069) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 46538069 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H33N3O4S/c1-5-30(6-2)26(21-12-10-16-24(18-21)34-4)20-28-27(31)22-13-11-17-25(19-22)35(32,33)29(3)23-14-8-7-9-15-23/h7-19,26H,5-6,20H2,1-4H3,(H,28,31) |
| InChIKey | YBUNXMJSERIVJP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |