C20H24F2N2O2 — CID 46545764
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-difluorobenzamide (PubChem CID 46545764) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 46545764 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3,4-difluorobenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(F)c(F)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-4-24(5-2)19(14-7-6-8-16(11-14)26-3)13-23-20(25)15-9-10-17(21)18(22)12-15/h6-12,19H,4-5,13H2,1-3H3,(H,23,25) |
| InChIKey | AJKFOSWAZLVXQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |