C23H27FN4O2 — CID 55652048
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 55652048) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55652048 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccn(-c2ccccc2F)n1)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H27FN4O2/c1-4-27(5-2)22(17-9-8-10-18(15-17)30-3)16-25-23(29)20-13-14-28(26-20)21-12-7-6-11-19(21)24/h6-15,22H,4-5,16H2,1-3H3,(H,25,29) |
| InChIKey | ADKTVGSUGMMCMN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |