C21H28N2O4 — CID 134032750
N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide (PubChem CID 134032750) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 134032750 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(OC)cc1O)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-5-23(6-2)19(15-8-7-9-16(12-15)26-3)14-22-21(25)18-11-10-17(27-4)13-20(18)24/h7-13,19,24H,5-6,14H2,1-4H3,(H,22,25) |
| InChIKey | JURVPEILTFFFFO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |