C22H24ClN3O2 — CID 55836198
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(1,3-oxazol-5-yl)benzamide (PubChem CID 55836198) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(1,3-oxazol-5-yl)benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(1,3-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 55836198 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(1,3-oxazol-5-yl)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(-c2cnco2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H24ClN3O2/c1-3-26(4-2)20(18-7-5-6-8-19(18)23)13-25-22(27)17-11-9-16(10-12-17)21-14-24-15-28-21/h5-12,14-15,20H,3-4,13H2,1-2H3,(H,25,27) |
| InChIKey | PCUIBHHTTGQJRE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |