C21H28ClN3O3S — CID 55934835
(2S)-2-(benzenesulfonamido)-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]propanamide (PubChem CID 55934835) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]propanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 55934835 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)C(CNC(=O)[C@H](C)NS(=O)(=O)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H28ClN3O3S/c1-4-25(5-2)20(18-13-9-10-14-19(18)22)15-23-21(26)16(3)24-29(27,28)17-11-7-6-8-12-17/h6-14,16,20,24H,4-5,15H2,1-3H3,(H,23,26)/t16-,20?/m0/s1 |
| InChIKey | MELOEKYVGPXBFV-DJZRFWRSSA-N |
| XLogP | 3.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |