C22H28ClN3O3S — CID 25494570
N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 25494570) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 25494570 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NC[C@H](c2ccccc2Cl)N(CC)CC)c1 |
| InChI | InChI=1S/C22H28ClN3O3S/c1-4-14-25-30(28,29)18-11-9-10-17(15-18)22(27)24-16-21(26(5-2)6-3)19-12-7-8-13-20(19)23/h4,7-13,15,21,25H,1,5-6,14,16H2,2-3H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | QLQYDLLBGCFTHJ-OAQYLSRUSA-N |
| XLogP | 3.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|